C6H9ClFS+ — CID 163740480
chloro-[(3E,5E)-6-fluorohexa-3,5-dien-3-yl]sulfanium (PubChem CID 163740480) has the molecular formula C6H9ClFS+ and a molecular weight of 167.66 g/mol. Its IUPAC name is chloro-[(3E,5E)-6-fluorohexa-3,5-dien-3-yl]sulfanium.
| Compound Name | chloro-[(3E,5E)-6-fluorohexa-3,5-dien-3-yl]sulfanium |
|---|---|
| PubChem CID | 163740480 |
| Molecular Formula | C6H9ClFS+ |
| Molecular Weight | 167.66 g/mol |
| Exact Mass | 167.01 |
| IUPAC Name | chloro-[(3E,5E)-6-fluorohexa-3,5-dien-3-yl]sulfanium |
| SMILES | CC/C(=C\C=C\F)[SH+]Cl |
| InChI | InChI=1S/C6H8ClFS/c1-2-6(9-7)4-3-5-8/h3-5H,2H2,1H3/p+1/b5-3+,6-4+ |
| InChIKey | LHHDGNXALMNERW-GGWOSOGESA-O |
| XLogP | 2.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.66 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|