C8H9FS — CID 135177208
4-fluoro-1-methylcyclohepta-2,4,6-triene-1-thiol (PubChem CID 135177208) has the molecular formula C8H9FS and a molecular weight of 156.22 g/mol. Its IUPAC name is 4-fluoro-1-methylcyclohepta-2,4,6-triene-1-thiol.
| Compound Name | 4-fluoro-1-methylcyclohepta-2,4,6-triene-1-thiol |
|---|---|
| PubChem CID | 135177208 |
| Molecular Formula | C8H9FS |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 4-fluoro-1-methylcyclohepta-2,4,6-triene-1-thiol |
| SMILES | CC1(S)C=CC=C(F)C=C1 |
| InChI | InChI=1S/C8H9FS/c1-8(10)5-2-3-7(9)4-6-8/h2-6,10H,1H3 |
| InChIKey | JCDGCXFPKTYYDS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|