C7H8F2 — CID 57025051
4,6-difluorohepta-1,2,4-triene (PubChem CID 57025051) has the molecular formula C7H8F2 and a molecular weight of 130.14 g/mol. Its IUPAC name is 4,6-difluorohepta-1,2,4-triene.
| Compound Name | 4,6-difluorohepta-1,2,4-triene |
|---|---|
| PubChem CID | 57025051 |
| Molecular Formula | C7H8F2 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 4,6-difluorohepta-1,2,4-triene |
| SMILES | C=C=CC(F)=CC(C)F |
| InChI | InChI=1S/C7H8F2/c1-3-4-7(9)5-6(2)8/h4-6H,1H2,2H3 |
| InChIKey | RUFLKFNJFVURGQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|