C6H8F2 — CID 140681783
2,4-difluorohexa-1,3-diene (PubChem CID 140681783) has the molecular formula C6H8F2 and a molecular weight of 118.13 g/mol. Its IUPAC name is 2,4-difluorohexa-1,3-diene.
| Compound Name | 2,4-difluorohexa-1,3-diene |
|---|---|
| PubChem CID | 140681783 |
| Molecular Formula | C6H8F2 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | 2,4-difluorohexa-1,3-diene |
| SMILES | C=C(F)C=C(F)CC |
| InChI | InChI=1S/C6H8F2/c1-3-6(8)4-5(2)7/h4H,2-3H2,1H3 |
| InChIKey | RPJFEKKJXXXOOY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|