C34H55NO6 — CID 163765711
2-[[(2S,5R,6R,11S,14S,16R)-6-ethyl-2-hydroxy-11-methyl-5-(5-oxo-2H-furan-3-yl)-14-tetracyclo[8.8.0.02,6.011,16]octadecanyl]oxy]-N-(6-hydroxyheptyl)acetamide (PubChem CID 163765711) has the molecular formula C34H55NO6 and a molecular weight of 573.82 g/mol. Its IUPAC name is 2-[[(2S,5R,6R,11S,14S,16R)-6-ethyl-2-hydroxy-11-methyl-5-(5-oxo-2H-furan-3-yl)-14-tetracyclo[8.8.0.02,6.011,16]octadecanyl]oxy]-N-(6-hydroxyheptyl)acetamide.
| Compound Name | 2-[[(2S,5R,6R,11S,14S,16R)-6-ethyl-2-hydroxy-11-methyl-5-(5-oxo-2H-furan-3-yl)-14-tetracyclo[8.8.0.02,6.011,16]octadecanyl]oxy]-N-(6-hydroxyheptyl)acetamide |
|---|---|
| PubChem CID | 163765711 |
| Molecular Formula | C34H55NO6 |
| Molecular Weight | 573.82 g/mol |
| Exact Mass | 573.40 |
| IUPAC Name | 2-[[(2S,5R,6R,11S,14S,16R)-6-ethyl-2-hydroxy-11-methyl-5-(5-oxo-2H-furan-3-yl)-14-tetracyclo[8.8.0.02,6.011,16]octadecanyl]oxy]-N-(6-hydroxyheptyl)acetamide |
| SMILES | CC[C@]12CCCC3C(CC[C@@H]4C[C@@H](OCC(=O)NCCCCCC(C)O)CC[C@]34C)[C@@]1(O)CC[C@@H]2C1=CC(=O)OC1 |
| InChI | InChI=1S/C34H55NO6/c1-4-33-15-8-10-28-29(34(33,39)17-14-27(33)24-19-31(38)41-21-24)12-11-25-20-26(13-16-32(25,28)3)40-22-30(37)35-18-7-5-6-9-23(2)36/h19,23,25-29,36,39H,4-18,20-22H2,1-3H3,(H,35,37)/t23?,25-,26+,27-,28?,29?,32+,33-,34+/m1/s1 |
| InChIKey | MCBYFIMKFNTZEP-HJOIRGFVSA-N |
| XLogP | 5.47 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.82 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|