C8H10N2O — CID 163766536
(E)-3-amino-1-(1,2-dihydropyridin-5-yl)prop-2-en-1-one (PubChem CID 163766536) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is (E)-3-amino-1-(1,2-dihydropyridin-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-amino-1-(1,2-dihydropyridin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 163766536 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (E)-3-amino-1-(1,2-dihydropyridin-5-yl)prop-2-en-1-one |
| SMILES | N/C=C/C(=O)C1=CNCC=C1 |
| InChI | InChI=1S/C8H10N2O/c9-4-3-8(11)7-2-1-5-10-6-7/h1-4,6,10H,5,9H2/b4-3+ |
| InChIKey | MCTPBUQXNZAYAX-ONEGZZNKSA-N |
| XLogP | 0.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|