C14H21N — CID 143452613
ethane;5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,2-dihydropyridine (PubChem CID 143452613) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,2-dihydropyridine.
| Compound Name | ethane;5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 143452613 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | ethane;5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,2-dihydropyridine |
| SMILES | C=C(C)/C=C\C(=C)C1=CNCC=C1.CC |
| InChI | InChI=1S/C12H15N.C2H6/c1-10(2)6-7-11(3)12-5-4-8-13-9-12;1-2/h4-7,9,13H,1,3,8H2,2H3;1-2H3/b7-6-; |
| InChIKey | SFZDHLHBCWZMOQ-NAFXZHHSSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|