C10H11NS — CID 155706862
5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,3-thiazole (PubChem CID 155706862) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,3-thiazole.
| Compound Name | 5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 155706862 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,3-thiazole |
| SMILES | C=C(C)/C=C\C(=C)c1cncs1 |
| InChI | InChI=1S/C10H11NS/c1-8(2)4-5-9(3)10-6-11-7-12-10/h4-7H,1,3H2,2H3/b5-4- |
| InChIKey | FYCCRSNBFOXZAS-PLNGDYQASA-N |
| XLogP | 3.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|