C12H8N2S — CID 18925381
4-[1-(1,3-thiazol-5-yl)ethenyl]benzonitrile (PubChem CID 18925381) has the molecular formula C12H8N2S and a molecular weight of 212.28 g/mol. Its IUPAC name is 4-[1-(1,3-thiazol-5-yl)ethenyl]benzonitrile.
| Compound Name | 4-[1-(1,3-thiazol-5-yl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 18925381 |
| Molecular Formula | C12H8N2S |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 4-[1-(1,3-thiazol-5-yl)ethenyl]benzonitrile |
| SMILES | C=C(c1ccc(C#N)cc1)c1cncs1 |
| InChI | InChI=1S/C12H8N2S/c1-9(12-7-14-8-15-12)11-4-2-10(6-13)3-5-11/h2-5,7-8H,1H2 |
| InChIKey | BVVAHEKMSDKCOR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |