C6H4N2OS — CID 86690969
3-hydroxy-3-(1,3-thiazol-5-yl)prop-2-enenitrile (PubChem CID 86690969) has the molecular formula C6H4N2OS and a molecular weight of 152.18 g/mol. Its IUPAC name is 3-hydroxy-3-(1,3-thiazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-hydroxy-3-(1,3-thiazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 86690969 |
| Molecular Formula | C6H4N2OS |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.00 |
| IUPAC Name | 3-hydroxy-3-(1,3-thiazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC=C(O)c1cncs1 |
| InChI | InChI=1S/C6H4N2OS/c7-2-1-5(9)6-3-8-4-10-6/h1,3-4,9H |
| InChIKey | WKQSGGYIJFVKGP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|