C14H13FO — CID 134267997
4-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]benzoyl fluoride (PubChem CID 134267997) has the molecular formula C14H13FO and a molecular weight of 216.25 g/mol. Its IUPAC name is 4-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]benzoyl fluoride.
| Compound Name | 4-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]benzoyl fluoride |
|---|---|
| PubChem CID | 134267997 |
| Molecular Formula | C14H13FO |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]benzoyl fluoride |
| SMILES | C=C(C)/C=C\C(=C)c1ccc(C(=O)F)cc1 |
| InChI | InChI=1S/C14H13FO/c1-10(2)4-5-11(3)12-6-8-13(9-7-12)14(15)16/h4-9H,1,3H2,2H3/b5-4- |
| InChIKey | IRVSCISSIXTLMR-PLNGDYQASA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|