C17H20O2 — CID 89224685
1,2-dimethoxy-4-[(3Z)-6-methyl-5-methylidenehepta-1,3,6-trien-2-yl]benzene (PubChem CID 89224685) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 1,2-dimethoxy-4-[(3Z)-6-methyl-5-methylidenehepta-1,3,6-trien-2-yl]benzene.
| Compound Name | 1,2-dimethoxy-4-[(3Z)-6-methyl-5-methylidenehepta-1,3,6-trien-2-yl]benzene |
|---|---|
| PubChem CID | 89224685 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1,2-dimethoxy-4-[(3Z)-6-methyl-5-methylidenehepta-1,3,6-trien-2-yl]benzene |
| SMILES | C=C(C)C(=C)/C=C\C(=C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H20O2/c1-12(2)13(3)7-8-14(4)15-9-10-16(18-5)17(11-15)19-6/h7-11H,1,3-4H2,2,5-6H3/b8-7- |
| InChIKey | PYXKRWDNQGVZDR-FPLPWBNLSA-N |
| XLogP | 4.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|