C19H24ClN5O3S — CID 163766791
(4aR)-6-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methyl]-1-methyl-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one (PubChem CID 163766791) has the molecular formula C19H24ClN5O3S and a molecular weight of 437.95 g/mol. Its IUPAC name is (4aR)-6-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methyl]-1-methyl-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one.
| Compound Name | (4aR)-6-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methyl]-1-methyl-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 163766791 |
| Molecular Formula | C19H24ClN5O3S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (4aR)-6-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methyl]-1-methyl-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one |
| SMILES | CN1C(=O)CO[C@@H]2CN(Cc3cc4nc(Cl)nc(N5CCOCC5)c4s3)CCC21 |
| InChI | InChI=1S/C19H24ClN5O3S/c1-23-14-2-3-24(10-15(14)28-11-16(23)26)9-12-8-13-17(29-12)18(22-19(20)21-13)25-4-6-27-7-5-25/h8,14-15H,2-7,9-11H2,1H3/t14?,15-/m1/s1 |
| InChIKey | MCZKMSOPFKTBQQ-YSSOQSIOSA-N |
| XLogP | 1.61 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |