C11H23NO2 — CID 163766830
4-aminooxy-3,4-dimethyl-3-propylhexan-2-one (PubChem CID 163766830) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-aminooxy-3,4-dimethyl-3-propylhexan-2-one.
| Compound Name | 4-aminooxy-3,4-dimethyl-3-propylhexan-2-one |
|---|---|
| PubChem CID | 163766830 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 4-aminooxy-3,4-dimethyl-3-propylhexan-2-one |
| SMILES | CCCC(C)(C(C)=O)C(C)(CC)ON |
| InChI | InChI=1S/C11H23NO2/c1-6-8-10(4,9(3)13)11(5,7-2)14-12/h6-8,12H2,1-5H3 |
| InChIKey | MDAJAQVLXBANKO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|