C13H26O3 — CID 121480979
methoxymethyl 2,3,3-trimethyl-2-propylpentanoate (PubChem CID 121480979) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is methoxymethyl 2,3,3-trimethyl-2-propylpentanoate.
| Compound Name | methoxymethyl 2,3,3-trimethyl-2-propylpentanoate |
|---|---|
| PubChem CID | 121480979 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | methoxymethyl 2,3,3-trimethyl-2-propylpentanoate |
| SMILES | CCCC(C)(C(=O)OCOC)C(C)(C)CC |
| InChI | InChI=1S/C13H26O3/c1-7-9-13(5,12(3,4)8-2)11(14)16-10-15-6/h7-10H2,1-6H3 |
| InChIKey | REJXUKYTRLBBIV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|