C14H15BN2O2S — CID 163768637
CID 163768637 (PubChem CID 163768637) has the molecular formula C14H15BN2O2S and a molecular weight of 286.17 g/mol.
| Compound Name | CID 163768637 |
|---|---|
| PubChem CID | 163768637 |
| Molecular Formula | C14H15BN2O2S |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(S(=O)(=O)Nc2cccc(CC)n2)cc1C |
| InChI | InChI=1S/C14H15BN2O2S/c1-3-11-5-4-6-14(16-11)17-20(18,19)12-7-8-13(15)10(2)9-12/h4-9H,3H2,1-2H3,(H,16,17) |
| InChIKey | CQBDTCWISSHYNI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|