C12H12FN3O2S — CID 82343421
N-[6-(aminomethyl)-2-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 82343421) has the molecular formula C12H12FN3O2S and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[6-(aminomethyl)-2-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[6-(aminomethyl)-2-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 82343421 |
| Molecular Formula | C12H12FN3O2S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | N-[6-(aminomethyl)-2-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | NCc1cccc(NS(=O)(=O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H12FN3O2S/c13-9-4-6-11(7-5-9)19(17,18)16-12-3-1-2-10(8-14)15-12/h1-7H,8,14H2,(H,15,16) |
| InChIKey | WEXJBEKSOOUPGA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |