C20H16F4N2O3S — CID 11611930
N-[6-[(4-fluorophenyl)methoxymethyl]-2-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 11611930) has the molecular formula C20H16F4N2O3S and a molecular weight of 440.42 g/mol. Its IUPAC name is N-[6-[(4-fluorophenyl)methoxymethyl]-2-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[6-[(4-fluorophenyl)methoxymethyl]-2-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11611930 |
| Molecular Formula | C20H16F4N2O3S |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-[6-[(4-fluorophenyl)methoxymethyl]-2-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(COCc2ccc(F)cc2)n1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F4N2O3S/c21-16-9-7-14(8-10-16)12-29-13-17-4-2-6-19(25-17)26-30(27,28)18-5-1-3-15(11-18)20(22,23)24/h1-11H,12-13H2,(H,25,26) |
| InChIKey | GSKCHOBEPOJHQQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |