C16H16F4N2O3S — CID 86604239
N-[5-(2-fluoroethoxymethyl)-6-methyl-2-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 86604239) has the molecular formula C16H16F4N2O3S and a molecular weight of 392.37 g/mol. Its IUPAC name is N-[5-(2-fluoroethoxymethyl)-6-methyl-2-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[5-(2-fluoroethoxymethyl)-6-methyl-2-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 86604239 |
| Molecular Formula | C16H16F4N2O3S |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-[5-(2-fluoroethoxymethyl)-6-methyl-2-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)ccc1COCCF |
| InChI | InChI=1S/C16H16F4N2O3S/c1-11-12(10-25-8-7-17)5-6-15(21-11)22-26(23,24)14-4-2-3-13(9-14)16(18,19)20/h2-6,9H,7-8,10H2,1H3,(H,21,22) |
| InChIKey | QEVFEKSJFUQAQL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|