C25H17N7O2 — CID 163768871
methanimidoyl 3-[4-[3-(1,3,4-oxadiazol-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzenecarboximidate (PubChem CID 163768871) has the molecular formula C25H17N7O2 and a molecular weight of 447.46 g/mol. Its IUPAC name is methanimidoyl 3-[4-[3-(1,3,4-oxadiazol-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzenecarboximidate.
| Compound Name | methanimidoyl 3-[4-[3-(1,3,4-oxadiazol-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 163768871 |
| Molecular Formula | C25H17N7O2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | methanimidoyl 3-[4-[3-(1,3,4-oxadiazol-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzenecarboximidate |
| SMILES | [H]/N=C(\O/C=N/[H])c1cccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4nnco4)c3)n2)c1 |
| InChI | InChI=1S/C25H17N7O2/c26-14-33-21(27)17-8-4-9-18(12-17)23-29-22(16-6-2-1-3-7-16)30-24(31-23)19-10-5-11-20(13-19)25-32-28-15-34-25/h1-15,26-27H/b26-14+,27-21- |
| InChIKey | MESMDNGVFVKPPJ-XNTQGQOBSA-N |
| XLogP | 4.87 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|