About methanimidoyl 3-bromobenzenecarboximidate
methanimidoyl 3-bromobenzenecarboximidate (PubChem CID 126634073) has the molecular formula C8H7BrN2O
and a molecular weight of 227.06 g/mol. Its IUPAC name is methanimidoyl 3-bromobenzenecarboximidate.
Molecular Properties
| Compound Name | methanimidoyl 3-bromobenzenecarboximidate |
| PubChem CID | 126634073 |
| Molecular Formula | C8H7BrN2O |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.97 |
| IUPAC Name | methanimidoyl 3-bromobenzenecarboximidate |
| SMILES | [H]/N=C(\O/C=N/[H])c1cccc(Br)c1 |
| InChI | InChI=1S/C8H7BrN2O/c9-7-3-1-2-6(4-7)8(11)12-5-10/h1-5,10-11H/b10-5+,11-8- |
| InChIKey | XHDPWSJISZEUJW-REZFLJOXSA-N |
| XLogP | 2.40 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methanimidoyl 3-bromobenzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanimidoyl 3-bromobenzenecarboximidate?
The IUPAC name of methanimidoyl 3-bromobenzenecarboximidate (CID 126634073) is methanimidoyl 3-bromobenzenecarboximidate.
What is the SMILES notation for methanimidoyl 3-bromobenzenecarboximidate?
The canonical SMILES for methanimidoyl 3-bromobenzenecarboximidate is [H]/N=C(\O/C=N/[H])c1cccc(Br)c1.
What is the InChIKey of methanimidoyl 3-bromobenzenecarboximidate?
The InChIKey is XHDPWSJISZEUJW-REZFLJOXSA-N. The full InChI is InChI=1S/C8H7BrN2O/c9-7-3-1-2-6(4-7)8(11)12-5-10/h1-5,10-11H/b10-5+,11-8-.
What are the key properties of methanimidoyl 3-bromobenzenecarboximidate?
methanimidoyl 3-bromobenzenecarboximidate has a molecular weight of 227.06 g/mol, XLogP of 2.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanimidoyl 3-bromobenzenecarboximidate is sourced from PubChem (CID 126634073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).