C14H10F3N3O — CID 143801261
methanimidoyl 2,4-difluoro-5-(3-fluoroanilino)benzenecarboximidate (PubChem CID 143801261) has the molecular formula C14H10F3N3O and a molecular weight of 293.25 g/mol. Its IUPAC name is methanimidoyl 2,4-difluoro-5-(3-fluoroanilino)benzenecarboximidate.
| Compound Name | methanimidoyl 2,4-difluoro-5-(3-fluoroanilino)benzenecarboximidate |
|---|---|
| PubChem CID | 143801261 |
| Molecular Formula | C14H10F3N3O |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | methanimidoyl 2,4-difluoro-5-(3-fluoroanilino)benzenecarboximidate |
| SMILES | [H]/N=C(\O/C=N/[H])c1cc(Nc2cccc(F)c2)c(F)cc1F |
| InChI | InChI=1S/C14H10F3N3O/c15-8-2-1-3-9(4-8)20-13-5-10(14(19)21-7-18)11(16)6-12(13)17/h1-7,18-20H/b18-7+,19-14- |
| InChIKey | PTXCNYKQHAMMCE-GEOLQWJYSA-N |
| XLogP | 3.80 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|