About 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine
1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine (PubChem CID 143630982) has the molecular formula C16H18BrN3O
and a molecular weight of 348.24 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine.
Molecular Properties
| Compound Name | 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine |
| PubChem CID | 143630982 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine |
| SMILES | CN.[H]/N=C(C(=N/[H])/c1cccc(Br)c1)\c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H13BrN2O.CH5N/c1-19-13-7-5-10(6-8-13)14(17)15(18)11-3-2-4-12(16)9-11;1-2/h2-9,17-18H,1H3;2H2,1H3/b17-14+,18-15+; |
| InChIKey | GYICMOAQLOTPTN-MYRXNRIDSA-N |
| XLogP | 3.47 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine?
The IUPAC name of 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine (CID 143630982) is 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine.
What is the SMILES notation for 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine?
The canonical SMILES for 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine is CN.[H]/N=C(C(=N/[H])/c1cccc(Br)c1)\c1ccc(OC)cc1.
What is the InChIKey of 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine?
The InChIKey is GYICMOAQLOTPTN-MYRXNRIDSA-N. The full InChI is InChI=1S/C15H13BrN2O.CH5N/c1-19-13-7-5-10(6-8-13)14(17)15(18)11-3-2-4-12(16)9-11;1-2/h2-9,17-18H,1H3;2H2,1H3/b17-14+,18-15+;.
What are the key properties of 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine?
1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine has a molecular weight of 348.24 g/mol, XLogP of 3.47, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine is sourced from PubChem (CID 143630982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).