C16H18BrN3O — CID 143630982
1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine (PubChem CID 143630982) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine.
| Compound Name | 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine |
|---|---|
| PubChem CID | 143630982 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1-(3-bromophenyl)-2-(4-methoxyphenyl)ethane-1,2-diimine;methanamine |
| SMILES | CN.[H]/N=C(C(=N/[H])/c1cccc(Br)c1)\c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H13BrN2O.CH5N/c1-19-13-7-5-10(6-8-13)14(17)15(18)11-3-2-4-12(16)9-11;1-2/h2-9,17-18H,1H3;2H2,1H3/b17-14+,18-15+; |
| InChIKey | GYICMOAQLOTPTN-MYRXNRIDSA-N |
| XLogP | 3.47 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|