C9H12F2O — CID 163770846
2-(3,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol (PubChem CID 163770846) has the molecular formula C9H12F2O and a molecular weight of 174.19 g/mol. Its IUPAC name is 2-(3,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol.
| Compound Name | 2-(3,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 163770846 |
| Molecular Formula | C9H12F2O |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2-(3,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol |
| SMILES | CC(CO)C1=CC(F)=CC(F)C1 |
| InChI | InChI=1S/C9H12F2O/c1-6(5-12)7-2-8(10)4-9(11)3-7/h2,4,6,9,12H,3,5H2,1H3 |
| InChIKey | MGHQIARSCGFUAT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |