C8H16O5P+ — CID 163771916
2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol (PubChem CID 163771916) has the molecular formula C8H16O5P+ and a molecular weight of 223.18 g/mol. Its IUPAC name is 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol.
| Compound Name | 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol |
|---|---|
| PubChem CID | 163771916 |
| Molecular Formula | C8H16O5P+ |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol |
| SMILES | CC1(C)COP(=O)(CO[CH+]CO)OC1 |
| InChI | InChI=1S/C8H16O5P/c1-8(2)5-12-14(10,13-6-8)7-11-4-3-9/h4,9H,3,5-7H2,1-2H3/q+1 |
| InChIKey | MHDUAZRFJGBNJN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|