About (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one
(4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one (PubChem CID 163773112) has the molecular formula C11H14N2O3
and a molecular weight of 222.24 g/mol. Its IUPAC name is (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one |
| PubChem CID | 163773112 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one |
| SMILES | C=c1c(=O)[nH]cn/c1=C/C(OC)=C(\C)OC |
| InChI | InChI=1S/C11H14N2O3/c1-7-9(12-6-13-11(7)14)5-10(16-4)8(2)15-3/h5-6H,1H2,2-4H3,(H,12,13,14)/b9-5+,10-8- |
| InChIKey | MICOCLFJMYSBOO-SXIMUEDZSA-N |
| XLogP | -0.51 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one?
The IUPAC name of (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one (CID 163773112) is (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one.
What is the SMILES notation for (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one?
The canonical SMILES for (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one is C=c1c(=O)[nH]cn/c1=C/C(OC)=C(\C)OC.
What is the InChIKey of (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one?
The InChIKey is MICOCLFJMYSBOO-SXIMUEDZSA-N. The full InChI is InChI=1S/C11H14N2O3/c1-7-9(12-6-13-11(7)14)5-10(16-4)8(2)15-3/h5-6H,1H2,2-4H3,(H,12,13,14)/b9-5+,10-8-.
What are the key properties of (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one?
(4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one has a molecular weight of 222.24 g/mol, XLogP of -0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1H-pyrimidin-6-one is sourced from PubChem (CID 163773112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).