C10H12N2O3 — CID 136658234
methyl 2-(5-ethylidene-6-oxo-1H-pyrimidin-4-ylidene)propanoate (PubChem CID 136658234) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is methyl 2-(5-ethylidene-6-oxo-1H-pyrimidin-4-ylidene)propanoate.
| Compound Name | methyl 2-(5-ethylidene-6-oxo-1H-pyrimidin-4-ylidene)propanoate |
|---|---|
| PubChem CID | 136658234 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | methyl 2-(5-ethylidene-6-oxo-1H-pyrimidin-4-ylidene)propanoate |
| SMILES | CC=c1c(=C(C)C(=O)OC)nc[nH]c1=O |
| InChI | InChI=1S/C10H12N2O3/c1-4-7-8(6(2)10(14)15-3)11-5-12-9(7)13/h4-5H,1-3H3,(H,11,12,13) |
| InChIKey | FXWJMEJTZIUPIK-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |