C7H4ClF2INO3- — CID 163774023
(5-carboxy-3-chloro-2,4-difluorophenyl)-oxidoazanium iodide (PubChem CID 163774023) has the molecular formula C7H4ClF2INO3- and a molecular weight of 350.47 g/mol. Its IUPAC name is (5-carboxy-3-chloro-2,4-difluorophenyl)-oxidoazanium iodide.
| Compound Name | (5-carboxy-3-chloro-2,4-difluorophenyl)-oxidoazanium iodide |
|---|---|
| PubChem CID | 163774023 |
| Molecular Formula | C7H4ClF2INO3- |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 349.89 |
| IUPAC Name | (5-carboxy-3-chloro-2,4-difluorophenyl)-oxidoazanium iodide |
| SMILES | O=C(O)c1cc([NH2+][O-])c(F)c(Cl)c1F.[I-] |
| InChI | InChI=1S/C7H4ClF2NO3.HI/c8-4-5(9)2(7(12)13)1-3(11-14)6(4)10;/h1H,11H2,(H,12,13);1H/p-1 |
| InChIKey | CWXPYUDBEPOHRV-UHFFFAOYSA-M |
| XLogP | -1.99 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|