C25H26N4O5 — CID 163774824
[(4S)-4-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]methyl 2,2-diphenylacetate (PubChem CID 163774824) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is [(4S)-4-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]methyl 2,2-diphenylacetate.
| Compound Name | [(4S)-4-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]methyl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 163774824 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [(4S)-4-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]methyl 2,2-diphenylacetate |
| SMILES | CN(C)/C=N/c1ccn([C@@H]2COC(COC(=O)C(c3ccccc3)c3ccccc3)O2)c(=O)n1 |
| InChI | InChI=1S/C25H26N4O5/c1-28(2)17-26-20-13-14-29(25(31)27-20)21-15-32-22(34-21)16-33-24(30)23(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14,17,21-23H,15-16H2,1-2H3/b26-17+/t21-,22?/m0/s1 |
| InChIKey | MJMPTUMCKVCHEN-GWOIGVCZSA-N |
| XLogP | 2.71 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|