C14H22ClFN6 — CID 163782596
2-[1-(3-chloro-4-fluorophenyl)-6-(diaminomethylideneamino)hexyl]guanidine (PubChem CID 163782596) has the molecular formula C14H22ClFN6 and a molecular weight of 328.82 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-fluorophenyl)-6-(diaminomethylideneamino)hexyl]guanidine.
| Compound Name | 2-[1-(3-chloro-4-fluorophenyl)-6-(diaminomethylideneamino)hexyl]guanidine |
|---|---|
| PubChem CID | 163782596 |
| Molecular Formula | C14H22ClFN6 |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-[1-(3-chloro-4-fluorophenyl)-6-(diaminomethylideneamino)hexyl]guanidine |
| SMILES | NC(N)=NCCCCCC(N=C(N)N)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H22ClFN6/c15-10-8-9(5-6-11(10)16)12(22-14(19)20)4-2-1-3-7-21-13(17)18/h5-6,8,12H,1-4,7H2,(H4,17,18,21)(H4,19,20,22) |
| InChIKey | MPVMHHVXOFBVBA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|