C36H64N2O8 — CID 163783004
4-O-[[4-[[3-(butan-2-ylamino)-4-cyclohexyloxy-4-hydroxybutanoyl]oxymethyl]cyclohexyl]methyl] 1-O-cyclohexyl 2-(butan-2-ylamino)butanedioate (PubChem CID 163783004) has the molecular formula C36H64N2O8 and a molecular weight of 652.91 g/mol. Its IUPAC name is 4-O-[[4-[[3-(butan-2-ylamino)-4-cyclohexyloxy-4-hydroxybutanoyl]oxymethyl]cyclohexyl]methyl] 1-O-cyclohexyl 2-(butan-2-ylamino)butanedioate.
| Compound Name | 4-O-[[4-[[3-(butan-2-ylamino)-4-cyclohexyloxy-4-hydroxybutanoyl]oxymethyl]cyclohexyl]methyl] 1-O-cyclohexyl 2-(butan-2-ylamino)butanedioate |
|---|---|
| PubChem CID | 163783004 |
| Molecular Formula | C36H64N2O8 |
| Molecular Weight | 652.91 g/mol |
| Exact Mass | 652.47 |
| IUPAC Name | 4-O-[[4-[[3-(butan-2-ylamino)-4-cyclohexyloxy-4-hydroxybutanoyl]oxymethyl]cyclohexyl]methyl] 1-O-cyclohexyl 2-(butan-2-ylamino)butanedioate |
| SMILES | CCC(C)NC(CC(=O)OCC1CCC(COC(=O)CC(NC(C)CC)C(O)OC2CCCCC2)CC1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C36H64N2O8/c1-5-25(3)37-31(35(41)45-29-13-9-7-10-14-29)21-33(39)43-23-27-17-19-28(20-18-27)24-44-34(40)22-32(38-26(4)6-2)36(42)46-30-15-11-8-12-16-30/h25-32,35,37-38,41H,5-24H2,1-4H3 |
| InChIKey | MQEWJHVDVSNKPC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.91 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|