C21H41NO5 — CID 143247276
[4-(hydroxymethyl)cyclohexyl]methyl 3-(butan-2-ylamino)-4-oxobutanoate;1-methoxybutane (PubChem CID 143247276) has the molecular formula C21H41NO5 and a molecular weight of 387.56 g/mol. Its IUPAC name is [4-(hydroxymethyl)cyclohexyl]methyl 3-(butan-2-ylamino)-4-oxobutanoate;1-methoxybutane.
| Compound Name | [4-(hydroxymethyl)cyclohexyl]methyl 3-(butan-2-ylamino)-4-oxobutanoate;1-methoxybutane |
|---|---|
| PubChem CID | 143247276 |
| Molecular Formula | C21H41NO5 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | [4-(hydroxymethyl)cyclohexyl]methyl 3-(butan-2-ylamino)-4-oxobutanoate;1-methoxybutane |
| SMILES | CCC(C)NC(C=O)CC(=O)OCC1CCC(CO)CC1.CCCCOC |
| InChI | InChI=1S/C16H29NO4.C5H12O/c1-3-12(2)17-15(10-19)8-16(20)21-11-14-6-4-13(9-18)5-7-14;1-3-4-5-6-2/h10,12-15,17-18H,3-9,11H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | UNADRBBJCOJKNN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|