About cyclopropylmethyl 2-methylhexanoate
cyclopropylmethyl 2-methylhexanoate (PubChem CID 67151240) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is cyclopropylmethyl 2-methylhexanoate.
Molecular Properties
| Compound Name | cyclopropylmethyl 2-methylhexanoate |
| PubChem CID | 67151240 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | cyclopropylmethyl 2-methylhexanoate |
| SMILES | CCCCC(C)C(=O)OCC1CC1 |
| InChI | InChI=1S/C11H20O2/c1-3-4-5-9(2)11(12)13-8-10-6-7-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | FFWNQLIBSZWYQO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropylmethyl 2-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethyl 2-methylhexanoate?
The IUPAC name of cyclopropylmethyl 2-methylhexanoate (CID 67151240) is cyclopropylmethyl 2-methylhexanoate.
What is the SMILES notation for cyclopropylmethyl 2-methylhexanoate?
The canonical SMILES for cyclopropylmethyl 2-methylhexanoate is CCCCC(C)C(=O)OCC1CC1.
What is the InChIKey of cyclopropylmethyl 2-methylhexanoate?
The InChIKey is FFWNQLIBSZWYQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-3-4-5-9(2)11(12)13-8-10-6-7-10/h9-10H,3-8H2,1-2H3.
What are the key properties of cyclopropylmethyl 2-methylhexanoate?
cyclopropylmethyl 2-methylhexanoate has a molecular weight of 184.28 g/mol, XLogP of 2.77, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethyl 2-methylhexanoate is sourced from PubChem (CID 67151240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).