C31H28F2N6O5 — CID 163783599
(5S)-5-[(1E,3E)-4-[[2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-5-oxo-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]hexa-1,3,5-trienyl]-5-methylimidazolidine-2,4-dione (PubChem CID 163783599) has the molecular formula C31H28F2N6O5 and a molecular weight of 602.60 g/mol. Its IUPAC name is (5S)-5-[(1E,3E)-4-[[2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-5-oxo-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]hexa-1,3,5-trienyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(1E,3E)-4-[[2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-5-oxo-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]hexa-1,3,5-trienyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 163783599 |
| Molecular Formula | C31H28F2N6O5 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | (5S)-5-[(1E,3E)-4-[[2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-5-oxo-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]hexa-1,3,5-trienyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C=C/C(=C\C=C\[C@]1(C)NC(=O)NC1=O)Nc1nc(-c2c(F)cccc2F)nc2c1C(=O)N(Cc1ccc(OC)cc1OC)C2 |
| InChI | InChI=1S/C31H28F2N6O5/c1-5-18(8-7-13-31(2)29(41)37-30(42)38-31)34-27-25-22(35-26(36-27)24-20(32)9-6-10-21(24)33)16-39(28(25)40)15-17-11-12-19(43-3)14-23(17)44-4/h5-14H,1,15-16H2,2-4H3,(H,34,35,36)(H2,37,38,41,42)/b13-7+,18-8+/t31-/m0/s1 |
| InChIKey | MQRQESWFPDOILK-CESVPQHRSA-N |
| XLogP | 4.23 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|