C23H24IN7O — CID 163785274
[3-(4-cyclopropyl-1,2,4-triazol-3-yl)anilino]-[4-[6-[iodo(methyl)amino]-3-pyridinyl]-1,2-dihydropyridin-2-yl]methanol (PubChem CID 163785274) has the molecular formula C23H24IN7O and a molecular weight of 541.40 g/mol. Its IUPAC name is [3-(4-cyclopropyl-1,2,4-triazol-3-yl)anilino]-[4-[6-[iodo(methyl)amino]-3-pyridinyl]-1,2-dihydropyridin-2-yl]methanol.
| Compound Name | [3-(4-cyclopropyl-1,2,4-triazol-3-yl)anilino]-[4-[6-[iodo(methyl)amino]-3-pyridinyl]-1,2-dihydropyridin-2-yl]methanol |
|---|---|
| PubChem CID | 163785274 |
| Molecular Formula | C23H24IN7O |
| Molecular Weight | 541.40 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | [3-(4-cyclopropyl-1,2,4-triazol-3-yl)anilino]-[4-[6-[iodo(methyl)amino]-3-pyridinyl]-1,2-dihydropyridin-2-yl]methanol |
| SMILES | CN(I)c1ccc(C2=CC(C(O)Nc3cccc(-c4nncn4C4CC4)c3)NC=C2)cn1 |
| InChI | InChI=1S/C23H24IN7O/c1-30(24)21-8-5-17(13-26-21)15-9-10-25-20(12-15)23(32)28-18-4-2-3-16(11-18)22-29-27-14-31(22)19-6-7-19/h2-5,8-14,19-20,23,25,28,32H,6-7H2,1H3 |
| InChIKey | MRZTWWBJHVKADT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|