C19H28N3O2S+ — CID 163785404
tert-butyl-[2-[2-[(1R,3S,5R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl]sulfanium (PubChem CID 163785404) has the molecular formula C19H28N3O2S+ and a molecular weight of 362.52 g/mol. Its IUPAC name is tert-butyl-[2-[2-[(1R,3S,5R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl]sulfanium.
| Compound Name | tert-butyl-[2-[2-[(1R,3S,5R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl]sulfanium |
|---|---|
| PubChem CID | 163785404 |
| Molecular Formula | C19H28N3O2S+ |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | tert-butyl-[2-[2-[(1R,3S,5R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl]sulfanium |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C[C@@H]2C[C@H]1c1ncc(C#C[SH+]C(C)(C)C)[nH]1 |
| InChI | InChI=1S/C19H27N3O2S/c1-18(2,3)24-17(23)22-14-9-12(14)10-15(22)16-20-11-13(21-16)7-8-25-19(4,5)6/h11-12,14-15H,9-10H2,1-6H3,(H,20,21)/p+1/t12-,14-,15+/m1/s1 |
| InChIKey | MSCPWUHPHIPUTF-YUELXQCFSA-O |
| XLogP | 3.40 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|