C22H25NO3 — CID 163785752
ethyl 3-(1-benzofuran-6-yl)-3-[methyl-[(1R)-1-phenylethyl]amino]propanoate (PubChem CID 163785752) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is ethyl 3-(1-benzofuran-6-yl)-3-[methyl-[(1R)-1-phenylethyl]amino]propanoate.
| Compound Name | ethyl 3-(1-benzofuran-6-yl)-3-[methyl-[(1R)-1-phenylethyl]amino]propanoate |
|---|---|
| PubChem CID | 163785752 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | ethyl 3-(1-benzofuran-6-yl)-3-[methyl-[(1R)-1-phenylethyl]amino]propanoate |
| SMILES | CCOC(=O)CC(c1ccc2ccoc2c1)N(C)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H25NO3/c1-4-25-22(24)15-20(19-11-10-18-12-13-26-21(18)14-19)23(3)16(2)17-8-6-5-7-9-17/h5-14,16,20H,4,15H2,1-3H3/t16-,20?/m1/s1 |
| InChIKey | MSJIOVBHCAVPAU-QRIPLOBPSA-N |
| XLogP | 5.12 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |