C10H8N6O2 — CID 163786189
6-[[6-(methylideneamino)pyrimidin-4-yl]amino]pyrimidine-4-carboxylic acid (PubChem CID 163786189) has the molecular formula C10H8N6O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 6-[[6-(methylideneamino)pyrimidin-4-yl]amino]pyrimidine-4-carboxylic acid.
| Compound Name | 6-[[6-(methylideneamino)pyrimidin-4-yl]amino]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 163786189 |
| Molecular Formula | C10H8N6O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 6-[[6-(methylideneamino)pyrimidin-4-yl]amino]pyrimidine-4-carboxylic acid |
| SMILES | C=Nc1cc(Nc2cc(C(=O)O)ncn2)ncn1 |
| InChI | InChI=1S/C10H8N6O2/c1-11-7-3-9(15-5-13-7)16-8-2-6(10(17)18)12-4-14-8/h2-5H,1H2,(H,17,18)(H,12,13,14,15,16) |
| InChIKey | MSTLTYXTHLOWSD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|