C6H8N2O6 — CID 139151595
pyrimidine-4,6-dicarboxylic acid;dihydrate (PubChem CID 139151595) has the molecular formula C6H8N2O6 and a molecular weight of 204.14 g/mol. Its IUPAC name is pyrimidine-4,6-dicarboxylic acid;dihydrate.
| Compound Name | pyrimidine-4,6-dicarboxylic acid;dihydrate |
|---|---|
| PubChem CID | 139151595 |
| Molecular Formula | C6H8N2O6 |
| Molecular Weight | 204.14 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | pyrimidine-4,6-dicarboxylic acid;dihydrate |
| SMILES | O.O.O=C(O)c1cc(C(=O)O)ncn1 |
| InChI | InChI=1S/C6H4N2O4.2H2O/c9-5(10)3-1-4(6(11)12)8-2-7-3;;/h1-2H,(H,9,10)(H,11,12);2*1H2 |
| InChIKey | SOXMIMZLVOXUNN-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 163.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.14 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |