About pyrimidine-4,6-dicarbonyl iodide
pyrimidine-4,6-dicarbonyl iodide (PubChem CID 149078134) has the molecular formula C6H2I2N2O2
and a molecular weight of 387.90 g/mol. Its IUPAC name is pyrimidine-4,6-dicarbonyl iodide.
Molecular Properties
| Compound Name | pyrimidine-4,6-dicarbonyl iodide |
| PubChem CID | 149078134 |
| Molecular Formula | C6H2I2N2O2 |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.82 |
| IUPAC Name | pyrimidine-4,6-dicarbonyl iodide |
| SMILES | O=C(I)c1cc(C(=O)I)ncn1 |
| InChI | InChI=1S/C6H2I2N2O2/c7-5(11)3-1-4(6(8)12)10-2-9-3/h1-2H |
| InChIKey | QPPBPFPAKUVFTM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze pyrimidine-4,6-dicarbonyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidine-4,6-dicarbonyl iodide?
The IUPAC name of pyrimidine-4,6-dicarbonyl iodide (CID 149078134) is pyrimidine-4,6-dicarbonyl iodide.
What is the SMILES notation for pyrimidine-4,6-dicarbonyl iodide?
The canonical SMILES for pyrimidine-4,6-dicarbonyl iodide is O=C(I)c1cc(C(=O)I)ncn1.
What is the InChIKey of pyrimidine-4,6-dicarbonyl iodide?
The InChIKey is QPPBPFPAKUVFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2I2N2O2/c7-5(11)3-1-4(6(8)12)10-2-9-3/h1-2H.
What are the key properties of pyrimidine-4,6-dicarbonyl iodide?
pyrimidine-4,6-dicarbonyl iodide has a molecular weight of 387.90 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidine-4,6-dicarbonyl iodide is sourced from PubChem (CID 149078134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).