C12H23NO — CID 163786666
2-[(5R)-6-ethyl-3-methoxy-5-methylcyclohex-2-en-1-yl]ethanamine (PubChem CID 163786666) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-[(5R)-6-ethyl-3-methoxy-5-methylcyclohex-2-en-1-yl]ethanamine.
| Compound Name | 2-[(5R)-6-ethyl-3-methoxy-5-methylcyclohex-2-en-1-yl]ethanamine |
|---|---|
| PubChem CID | 163786666 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-[(5R)-6-ethyl-3-methoxy-5-methylcyclohex-2-en-1-yl]ethanamine |
| SMILES | CCC1C(CCN)C=C(OC)C[C@H]1C |
| InChI | InChI=1S/C12H23NO/c1-4-12-9(2)7-11(14-3)8-10(12)5-6-13/h8-10,12H,4-7,13H2,1-3H3/t9-,10?,12?/m1/s1 |
| InChIKey | MTDQTJSZFHTIFV-GRZMOONWSA-N |
| XLogP | 2.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |