C30H60N2O4 — CID 163790724
10-O-(2-amino-2,6,6-trimethylheptan-4-yl) 1-O-[2-(ethylamino)-2-methylheptan-4-yl] decanedioate (PubChem CID 163790724) has the molecular formula C30H60N2O4 and a molecular weight of 512.82 g/mol. Its IUPAC name is 10-O-(2-amino-2,6,6-trimethylheptan-4-yl) 1-O-[2-(ethylamino)-2-methylheptan-4-yl] decanedioate.
| Compound Name | 10-O-(2-amino-2,6,6-trimethylheptan-4-yl) 1-O-[2-(ethylamino)-2-methylheptan-4-yl] decanedioate |
|---|---|
| PubChem CID | 163790724 |
| Molecular Formula | C30H60N2O4 |
| Molecular Weight | 512.82 g/mol |
| Exact Mass | 512.46 |
| IUPAC Name | 10-O-(2-amino-2,6,6-trimethylheptan-4-yl) 1-O-[2-(ethylamino)-2-methylheptan-4-yl] decanedioate |
| SMILES | CCCC(CC(C)(C)NCC)OC(=O)CCCCCCCCC(=O)OC(CC(C)(C)C)CC(C)(C)N |
| InChI | InChI=1S/C30H60N2O4/c1-10-18-24(23-30(8,9)32-11-2)35-26(33)19-16-14-12-13-15-17-20-27(34)36-25(21-28(3,4)5)22-29(6,7)31/h24-25,32H,10-23,31H2,1-9H3 |
| InChIKey | MWMBZADOGRGJDP-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.82 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|