C23H32N8O2 — CID 163791428
6-[1-[(3R)-3-aminopiperidin-1-yl]ethylideneamino]-5-(but-2-ynylamino)-3-[(4,6-dimethylpyrimidin-2-yl)methyl]-1-methylpyrimidine-2,4-dione (PubChem CID 163791428) has the molecular formula C23H32N8O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 6-[1-[(3R)-3-aminopiperidin-1-yl]ethylideneamino]-5-(but-2-ynylamino)-3-[(4,6-dimethylpyrimidin-2-yl)methyl]-1-methylpyrimidine-2,4-dione.
| Compound Name | 6-[1-[(3R)-3-aminopiperidin-1-yl]ethylideneamino]-5-(but-2-ynylamino)-3-[(4,6-dimethylpyrimidin-2-yl)methyl]-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163791428 |
| Molecular Formula | C23H32N8O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 6-[1-[(3R)-3-aminopiperidin-1-yl]ethylideneamino]-5-(but-2-ynylamino)-3-[(4,6-dimethylpyrimidin-2-yl)methyl]-1-methylpyrimidine-2,4-dione |
| SMILES | CC#CCNc1c(N=C(C)N2CCC[C@@H](N)C2)n(C)c(=O)n(Cc2nc(C)cc(C)n2)c1=O |
| InChI | InChI=1S/C23H32N8O2/c1-6-7-10-25-20-21(28-17(4)30-11-8-9-18(24)13-30)29(5)23(33)31(22(20)32)14-19-26-15(2)12-16(3)27-19/h12,18,25H,8-11,13-14,24H2,1-5H3/t18-/m1/s1 |
| InChIKey | MXCNUGRXNKIXSA-GOSISDBHSA-N |
| XLogP | 0.91 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|