C35H37F2N4O6+ — CID 163794655
[7-[5-[[4-(2-amino-2-oxoethyl)phenyl]carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoyl]oxyazanium (PubChem CID 163794655) has the molecular formula C35H37F2N4O6+ and a molecular weight of 647.70 g/mol. Its IUPAC name is [7-[5-[[4-(2-amino-2-oxoethyl)phenyl]carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoyl]oxyazanium.
| Compound Name | [7-[5-[[4-(2-amino-2-oxoethyl)phenyl]carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoyl]oxyazanium |
|---|---|
| PubChem CID | 163794655 |
| Molecular Formula | C35H37F2N4O6+ |
| Molecular Weight | 647.70 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | [7-[5-[[4-(2-amino-2-oxoethyl)phenyl]carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoyl]oxyazanium |
| SMILES | CC(C)n1c(C=CC(O)CC(O)CC(=O)O[NH3+])c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)c1C(=O)Nc1ccc(CC(N)=O)cc1 |
| InChI | InChI=1S/C35H36F2N4O6/c1-20(2)41-29(16-15-27(42)18-28(43)19-31(45)47-39)32(22-5-9-24(36)10-6-22)33(23-7-11-25(37)12-8-23)34(41)35(46)40-26-13-3-21(4-14-26)17-30(38)44/h3-16,20,27-28,42-43H,17-19H2,1-2,39H3,(H2-,38,40,44,46)/p+1 |
| InChIKey | MZSWXLVTEKLXNF-UHFFFAOYSA-O |
| XLogP | 4.18 |
| TPSA | 171.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.70 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|