C19H17F3N4O5 — CID 163795835
[(3aS,6R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-6-hydroxy-4-(2-hydroxyethyl)-7-methyl-1,3-dioxo-6,7a-dihydro-5H-4,7-epoxyisoindol-3a-yl]azaniumylideneazanide (PubChem CID 163795835) has the molecular formula C19H17F3N4O5 and a molecular weight of 438.36 g/mol. Its IUPAC name is [(3aS,6R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-6-hydroxy-4-(2-hydroxyethyl)-7-methyl-1,3-dioxo-6,7a-dihydro-5H-4,7-epoxyisoindol-3a-yl]azaniumylideneazanide.
| Compound Name | [(3aS,6R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-6-hydroxy-4-(2-hydroxyethyl)-7-methyl-1,3-dioxo-6,7a-dihydro-5H-4,7-epoxyisoindol-3a-yl]azaniumylideneazanide |
|---|---|
| PubChem CID | 163795835 |
| Molecular Formula | C19H17F3N4O5 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | [(3aS,6R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-6-hydroxy-4-(2-hydroxyethyl)-7-methyl-1,3-dioxo-6,7a-dihydro-5H-4,7-epoxyisoindol-3a-yl]azaniumylideneazanide |
| SMILES | CC12OC(CCO)(C[C@H]1O)[C@]1([NH+]=[N-])C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C21 |
| InChI | InChI=1S/C19H17F3N4O5/c1-16-12(28)7-17(31-16,4-5-27)18(25-24)13(16)14(29)26(15(18)30)10-3-2-9(8-23)11(6-10)19(20,21)22/h2-3,6,12-13,25,27-28H,4-5,7H2,1H3/t12-,13?,16?,17?,18-/m1/s1 |
| InChIKey | NAROSTBMENCQCZ-YCLJONOUSA-N |
| XLogP | -0.42 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|