C41H29N5 — CID 163796211
4,7-bis(5-methyl-3-pyridinyl)-2-phenyl-9-(4-pyridin-3-ylphenyl)-1,10-phenanthroline (PubChem CID 163796211) has the molecular formula C41H29N5 and a molecular weight of 591.72 g/mol. Its IUPAC name is 4,7-bis(5-methyl-3-pyridinyl)-2-phenyl-9-(4-pyridin-3-ylphenyl)-1,10-phenanthroline.
| Compound Name | 4,7-bis(5-methyl-3-pyridinyl)-2-phenyl-9-(4-pyridin-3-ylphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 163796211 |
| Molecular Formula | C41H29N5 |
| Molecular Weight | 591.72 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | 4,7-bis(5-methyl-3-pyridinyl)-2-phenyl-9-(4-pyridin-3-ylphenyl)-1,10-phenanthroline |
| SMILES | Cc1cncc(-c2cc(-c3ccccc3)nc3c2ccc2c(-c4cncc(C)c4)cc(-c4ccc(-c5cccnc5)cc4)nc23)c1 |
| InChI | InChI=1S/C41H29N5/c1-26-17-32(24-43-21-26)36-19-38(29-7-4-3-5-8-29)45-40-34(36)14-15-35-37(33-18-27(2)22-44-25-33)20-39(46-41(35)40)30-12-10-28(11-13-30)31-9-6-16-42-23-31/h3-25H,1-2H3 |
| InChIKey | NAZNNTHTNRVNHZ-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.72 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|