C30H33LiO — CID 163796901
lithium 2-trityloxybut-3-enylcycloheptane (PubChem CID 163796901) has the molecular formula C30H33LiO and a molecular weight of 416.53 g/mol. Its IUPAC name is lithium 2-trityloxybut-3-enylcycloheptane.
| Compound Name | lithium 2-trityloxybut-3-enylcycloheptane |
|---|---|
| PubChem CID | 163796901 |
| Molecular Formula | C30H33LiO |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | lithium 2-trityloxybut-3-enylcycloheptane |
| SMILES | [H]/[C-]=C\C(CC1CCCCCC1)OC(c1ccccc1)(c1ccccc1)c1ccccc1.[Li+] |
| InChI | InChI=1S/C30H33O.Li/c1-2-29(24-25-16-8-3-4-9-17-25)31-30(26-18-10-5-11-19-26,27-20-12-6-13-21-27)28-22-14-7-15-23-28;/h1-2,5-7,10-15,18-23,25,29H,3-4,8-9,16-17,24H2;/q-1;+1 |
| InChIKey | UUHVWMLBZIZVPP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|