C14H25NO — CID 163797859
(Z)-2-imino-11,11-dimethyldodec-9-en-3-one (PubChem CID 163797859) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (Z)-2-imino-11,11-dimethyldodec-9-en-3-one.
| Compound Name | (Z)-2-imino-11,11-dimethyldodec-9-en-3-one |
|---|---|
| PubChem CID | 163797859 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (Z)-2-imino-11,11-dimethyldodec-9-en-3-one |
| SMILES | [H]/N=C(\C)C(=O)CCCCC/C=C\C(C)(C)C |
| InChI | InChI=1S/C14H25NO/c1-12(15)13(16)10-8-6-5-7-9-11-14(2,3)4/h9,11,15H,5-8,10H2,1-4H3/b11-9-,15-12+ |
| InChIKey | NCJVOJWCKYEFRA-XOANFOMVSA-N |
| XLogP | 4.15 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|