C13H21NO — CID 123590001
6-imino-2-(4-methylpentyl)cyclohept-4-en-1-one (PubChem CID 123590001) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 6-imino-2-(4-methylpentyl)cyclohept-4-en-1-one.
| Compound Name | 6-imino-2-(4-methylpentyl)cyclohept-4-en-1-one |
|---|---|
| PubChem CID | 123590001 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 6-imino-2-(4-methylpentyl)cyclohept-4-en-1-one |
| SMILES | [H]/N=C1\C=CCC(CCCC(C)C)C(=O)C1 |
| InChI | InChI=1S/C13H21NO/c1-10(2)5-3-6-11-7-4-8-12(14)9-13(11)15/h4,8,10-11,14H,3,5-7,9H2,1-2H3/b14-12+ |
| InChIKey | UPJCJKGUBSMMKY-WYMLVPIESA-N |
| XLogP | 3.37 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|