C27H47NO — CID 90875133
(9E,12E)-13-ethyl-8-imino-4,9,10,15-tetramethyl-5-(3-methylbut-1-en-2-yl)hexadeca-9,12-dien-2-one (PubChem CID 90875133) has the molecular formula C27H47NO and a molecular weight of 401.68 g/mol. Its IUPAC name is (9E,12E)-13-ethyl-8-imino-4,9,10,15-tetramethyl-5-(3-methylbut-1-en-2-yl)hexadeca-9,12-dien-2-one.
| Compound Name | (9E,12E)-13-ethyl-8-imino-4,9,10,15-tetramethyl-5-(3-methylbut-1-en-2-yl)hexadeca-9,12-dien-2-one |
|---|---|
| PubChem CID | 90875133 |
| Molecular Formula | C27H47NO |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.37 |
| IUPAC Name | (9E,12E)-13-ethyl-8-imino-4,9,10,15-tetramethyl-5-(3-methylbut-1-en-2-yl)hexadeca-9,12-dien-2-one |
| SMILES | [H]/N=C(CCC(C(=C)C(C)C)C(C)CC(C)=O)\C(C)=C(/C)C/C=C(\CC)CC(C)C |
| InChI | InChI=1S/C27H47NO/c1-11-25(16-18(2)3)13-12-20(6)24(10)27(28)15-14-26(23(9)19(4)5)21(7)17-22(8)29/h13,18-19,21,26,28H,9,11-12,14-17H2,1-8,10H3/b24-20+,25-13+,28-27- |
| InChIKey | CDPLYKCPJXGSHW-ZEVHOSBHSA-N |
| XLogP | 8.34 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|